C42H36F2N8+2 — CID 91057634
5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-bis(4-fluorophenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91057634) has the molecular formula C42H36F2N8+2 and a molecular weight of 690.80 g/mol. Its IUPAC name is 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-bis(4-fluorophenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-bis(4-fluorophenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91057634 |
| Molecular Formula | C42H36F2N8+2 |
| Molecular Weight | 690.80 g/mol |
| Exact Mass | 690.30 |
| IUPAC Name | 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-bis(4-fluorophenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | Cn1cc[n+](C)c1C1=c2ccc([nH]2)=C(c2ccc(F)cc2)c2ccc([nH]2)C(c2n(C)cc[n+]2C)=c2ccc([nH]2)=C(c2ccc(F)cc2)c2ccc1[nH]2 |
| InChI | InChI=1S/C42H34F2N8/c1-49-21-22-50(2)41(49)39-33-17-13-29(45-33)37(25-5-9-27(43)10-6-25)31-15-19-35(47-31)40(42-51(3)23-24-52(42)4)36-20-16-32(48-36)38(30-14-18-34(39)46-30)26-7-11-28(44)12-8-26/h5-24H,1-4H3,(H2,45,46,47,48)/p+2 |
| InChIKey | HZIPKHBSGXJBOY-UHFFFAOYSA-P |
| XLogP | 2.91 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.80 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|