C39H57BFN3O5 — CID 91057962
tert-butyl N-[4-[3-[7-fluoro-1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamate (PubChem CID 91057962) has the molecular formula C39H57BFN3O5 and a molecular weight of 677.71 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[7-fluoro-1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[3-[7-fluoro-1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 91057962 |
| Molecular Formula | C39H57BFN3O5 |
| Molecular Weight | 677.71 g/mol |
| Exact Mass | 677.44 |
| IUPAC Name | tert-butyl N-[4-[3-[7-fluoro-1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamate |
| SMILES | COCCCn1c(C2CCCN(CCC(Cc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)NC(=O)OC(C)(C)C)C2)c(C)c2cccc(F)c21 |
| InChI | InChI=1S/C39H57BFN3O5/c1-27-32-14-10-15-33(41)35(32)44(22-12-24-46-9)34(27)29-13-11-21-43(26-29)23-20-31(42-36(45)47-37(2,3)4)25-28-16-18-30(19-17-28)40-48-38(5,6)39(7,8)49-40/h10,14-19,29,31H,11-13,20-26H2,1-9H3,(H,42,45) |
| InChIKey | VXNBZXYQLOOGFX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|