C14H8FNO4 — CID 91058052
3-(7-fluoro-1H-indol-3-yl)cyclohexane-1,2,4,5-tetrone (PubChem CID 91058052) has the molecular formula C14H8FNO4 and a molecular weight of 273.22 g/mol. Its IUPAC name is 3-(7-fluoro-1H-indol-3-yl)cyclohexane-1,2,4,5-tetrone.
| Compound Name | 3-(7-fluoro-1H-indol-3-yl)cyclohexane-1,2,4,5-tetrone |
|---|---|
| PubChem CID | 91058052 |
| Molecular Formula | C14H8FNO4 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 3-(7-fluoro-1H-indol-3-yl)cyclohexane-1,2,4,5-tetrone |
| SMILES | O=C1CC(=O)C(=O)C(c2c[nH]c3c(F)cccc23)C1=O |
| InChI | InChI=1S/C14H8FNO4/c15-8-3-1-2-6-7(5-16-12(6)8)11-13(19)9(17)4-10(18)14(11)20/h1-3,5,11,16H,4H2 |
| InChIKey | WLUGCMIEOOPETN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|