About 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol
1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol (PubChem CID 91058137) has the molecular formula C12H18N2O4
and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol |
| PubChem CID | 91058137 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol |
| SMILES | CC(C)C1OCC2C(CO1)N2n1c(O)ccc1O |
| InChI | InChI=1S/C12H18N2O4/c1-7(2)12-17-5-8-9(6-18-12)13(8)14-10(15)3-4-11(14)16/h3-4,7-9,12,15-16H,5-6H2,1-2H3 |
| InChIKey | IXZVWHMADKPPBH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 66.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol?
The IUPAC name of 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol (CID 91058137) is 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol.
What is the SMILES notation for 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol?
The canonical SMILES for 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol is CC(C)C1OCC2C(CO1)N2n1c(O)ccc1O.
What is the InChIKey of 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol?
The InChIKey is IXZVWHMADKPPBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4/c1-7(2)12-17-5-8-9(6-18-12)13(8)14-10(15)3-4-11(14)16/h3-4,7-9,12,15-16H,5-6H2,1-2H3.
What are the key properties of 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol?
1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol has a molecular weight of 254.29 g/mol, XLogP of 0.62, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-propan-2-yl-3,5-dioxa-8-azabicyclo[5.1.0]octan-8-yl)pyrrole-2,5-diol is sourced from PubChem (CID 91058137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).