C17H22N2 — CID 91058150
4-ethenyl-3,4,5,5-tetramethyl-3aH-imidazo[1,2-a]quinoline (PubChem CID 91058150) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 4-ethenyl-3,4,5,5-tetramethyl-3aH-imidazo[1,2-a]quinoline.
| Compound Name | 4-ethenyl-3,4,5,5-tetramethyl-3aH-imidazo[1,2-a]quinoline |
|---|---|
| PubChem CID | 91058150 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 4-ethenyl-3,4,5,5-tetramethyl-3aH-imidazo[1,2-a]quinoline |
| SMILES | C=CC1(C)C2N(C)C=CN2c2ccccc2C1(C)C |
| InChI | InChI=1S/C17H22N2/c1-6-17(4)15-18(5)11-12-19(15)14-10-8-7-9-13(14)16(17,2)3/h6-12,15H,1H2,2-5H3 |
| InChIKey | SNVLFAXTDLFWLN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|