About N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide
N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide (PubChem CID 91058188) has the molecular formula C14H25N3
and a molecular weight of 235.37 g/mol. Its IUPAC name is N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide |
| PubChem CID | 91058188 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide |
| SMILES | CC=N/C(=C\C(=CCCC)CC)N/C(C)=N/C |
| InChI | InChI=1S/C14H25N3/c1-6-9-10-13(7-2)11-14(16-8-3)17-12(4)15-5/h8,10-11H,6-7,9H2,1-5H3,(H,15,17)/b13-10?,14-11+,16-8? |
| InChIKey | VQMMIMNYIFKEAD-ZWDUZVBNSA-N |
| XLogP | 3.69 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide?
The IUPAC name of N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide (CID 91058188) is N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide.
What is the SMILES notation for N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide?
The canonical SMILES for N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide is CC=N/C(=C\C(=CCCC)CC)N/C(C)=N/C.
What is the InChIKey of N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide?
The InChIKey is VQMMIMNYIFKEAD-ZWDUZVBNSA-N. The full InChI is InChI=1S/C14H25N3/c1-6-9-10-13(7-2)11-14(16-8-3)17-12(4)15-5/h8,10-11H,6-7,9H2,1-5H3,(H,15,17)/b13-10?,14-11+,16-8?.
What are the key properties of N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide?
N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide has a molecular weight of 235.37 g/mol, XLogP of 3.69, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-3-ethyl-1-(ethylideneamino)hepta-1,3-dienyl]-N'-methylethanimidamide is sourced from PubChem (CID 91058188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).