C16H12F3NO4 — CID 91058731
2-oxo-3-[5-[[4-(trifluoromethyl)phenyl]methoxy]-2-pyridinyl]propanoic acid (PubChem CID 91058731) has the molecular formula C16H12F3NO4 and a molecular weight of 339.27 g/mol. Its IUPAC name is 2-oxo-3-[5-[[4-(trifluoromethyl)phenyl]methoxy]-2-pyridinyl]propanoic acid.
| Compound Name | 2-oxo-3-[5-[[4-(trifluoromethyl)phenyl]methoxy]-2-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 91058731 |
| Molecular Formula | C16H12F3NO4 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-oxo-3-[5-[[4-(trifluoromethyl)phenyl]methoxy]-2-pyridinyl]propanoic acid |
| SMILES | O=C(O)C(=O)Cc1ccc(OCc2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C16H12F3NO4/c17-16(18,19)11-3-1-10(2-4-11)9-24-13-6-5-12(20-8-13)7-14(21)15(22)23/h1-6,8H,7,9H2,(H,22,23) |
| InChIKey | OHXXGOIGICTCLN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|