C10H14ClN3OS2 — CID 91059259
6-chloro-N,4-diethyl-3H-thieno[3,2-e][1,2,4]thiadiazine-2-carboxamide (PubChem CID 91059259) has the molecular formula C10H14ClN3OS2 and a molecular weight of 291.83 g/mol. Its IUPAC name is 6-chloro-N,4-diethyl-3H-thieno[3,2-e][1,2,4]thiadiazine-2-carboxamide.
| Compound Name | 6-chloro-N,4-diethyl-3H-thieno[3,2-e][1,2,4]thiadiazine-2-carboxamide |
|---|---|
| PubChem CID | 91059259 |
| Molecular Formula | C10H14ClN3OS2 |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 6-chloro-N,4-diethyl-3H-thieno[3,2-e][1,2,4]thiadiazine-2-carboxamide |
| SMILES | CCNC(=O)N1CN(CC)c2cc(Cl)sc2S1 |
| InChI | InChI=1S/C10H14ClN3OS2/c1-3-12-10(15)14-6-13(4-2)7-5-8(11)16-9(7)17-14/h5H,3-4,6H2,1-2H3,(H,12,15) |
| InChIKey | PXBXRVSOPFKQCH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|