C25H30N2O8 — CID 91060038
4-(dimethylamino)-10-hydroxy-8-(hydroxymethyl)-7,12a-dimethoxy-12-methyl-1,3,11-trioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91060038) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is 4-(dimethylamino)-10-hydroxy-8-(hydroxymethyl)-7,12a-dimethoxy-12-methyl-1,3,11-trioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-10-hydroxy-8-(hydroxymethyl)-7,12a-dimethoxy-12-methyl-1,3,11-trioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91060038 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-(dimethylamino)-10-hydroxy-8-(hydroxymethyl)-7,12a-dimethoxy-12-methyl-1,3,11-trioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1c(CO)cc(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(OC)C(C)=C1C2=O |
| InChI | InChI=1S/C25H30N2O8/c1-10-16-11(6-13-17(20(16)30)15(29)8-12(9-28)22(13)34-4)7-14-19(27(2)3)21(31)18(24(26)33)23(32)25(10,14)35-5/h8,11,14,18-19,28-29H,6-7,9H2,1-5H3,(H2,26,33) |
| InChIKey | SZQGOJPVAVHFCP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|