About 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide
6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide (PubChem CID 91060410) has the molecular formula C17H30N2O3S
and a molecular weight of 342.51 g/mol. Its IUPAC name is 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide.
Molecular Properties
| Compound Name | 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide |
| PubChem CID | 91060410 |
| Molecular Formula | C17H30N2O3S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide |
| SMILES | CCCCCNC(=O)CCCCCn1c(O)cc(SCC)c1O |
| InChI | InChI=1S/C17H30N2O3S/c1-3-5-8-11-18-15(20)10-7-6-9-12-19-16(21)13-14(17(19)22)23-4-2/h13,21-22H,3-12H2,1-2H3,(H,18,20) |
| InChIKey | MMXKOQIZTAWXHV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide?
The IUPAC name of 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide (CID 91060410) is 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide.
What is the SMILES notation for 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide?
The canonical SMILES for 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide is CCCCCNC(=O)CCCCCn1c(O)cc(SCC)c1O.
What is the InChIKey of 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide?
The InChIKey is MMXKOQIZTAWXHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O3S/c1-3-5-8-11-18-15(20)10-7-6-9-12-19-16(21)13-14(17(19)22)23-4-2/h13,21-22H,3-12H2,1-2H3,(H,18,20).
What are the key properties of 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide?
6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide has a molecular weight of 342.51 g/mol, XLogP of 3.88, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-pentylhexanamide is sourced from PubChem (CID 91060410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).