About 4-pentan-2-yl-1,3-dioxolane
4-pentan-2-yl-1,3-dioxolane (PubChem CID 91060575) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 4-pentan-2-yl-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-pentan-2-yl-1,3-dioxolane |
| PubChem CID | 91060575 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 4-pentan-2-yl-1,3-dioxolane |
| SMILES | CCCC(C)C1COCO1 |
| InChI | InChI=1S/C8H16O2/c1-3-4-7(2)8-5-9-6-10-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | PYMVXJRRFOVUQR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-pentan-2-yl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentan-2-yl-1,3-dioxolane?
The IUPAC name of 4-pentan-2-yl-1,3-dioxolane (CID 91060575) is 4-pentan-2-yl-1,3-dioxolane.
What is the SMILES notation for 4-pentan-2-yl-1,3-dioxolane?
The canonical SMILES for 4-pentan-2-yl-1,3-dioxolane is CCCC(C)C1COCO1.
What is the InChIKey of 4-pentan-2-yl-1,3-dioxolane?
The InChIKey is PYMVXJRRFOVUQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-3-4-7(2)8-5-9-6-10-8/h7-8H,3-6H2,1-2H3.
What are the key properties of 4-pentan-2-yl-1,3-dioxolane?
4-pentan-2-yl-1,3-dioxolane has a molecular weight of 144.21 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentan-2-yl-1,3-dioxolane is sourced from PubChem (CID 91060575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).