C19H16F3N3O2S — CID 91060903
9-methanimidoyl-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-imine (PubChem CID 91060903) has the molecular formula C19H16F3N3O2S and a molecular weight of 407.42 g/mol. Its IUPAC name is 9-methanimidoyl-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-imine.
| Compound Name | 9-methanimidoyl-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-imine |
|---|---|
| PubChem CID | 91060903 |
| Molecular Formula | C19H16F3N3O2S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 9-methanimidoyl-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-imine |
| SMILES | [H]/N=C/C1/C(=N/[H])CC2c3ccccc3C1N2S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3N3O2S/c20-19(21,22)11-5-7-12(8-6-11)28(26,27)25-17-9-16(24)15(10-23)18(25)14-4-2-1-3-13(14)17/h1-8,10,15,17-18,23-24H,9H2/b23-10+,24-16+ |
| InChIKey | KQCJEBWSSFCRRA-SYPSPJEDSA-N |
| XLogP | 4.18 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|