C30H26FN3O7 — CID 91061032
(6S,6aR,7aS,8S,11aS)-8-(dimethylamino)-6-(4-fluorophenyl)-11a,14-dihydroxy-9,11,12,13-tetraoxo-6,6a,7,7a,8,12a-hexahydroanthra[3,2-g]quinoline-10-carboxamide (PubChem CID 91061032) has the molecular formula C30H26FN3O7 and a molecular weight of 559.55 g/mol. Its IUPAC name is (6S,6aR,7aS,8S,11aS)-8-(dimethylamino)-6-(4-fluorophenyl)-11a,14-dihydroxy-9,11,12,13-tetraoxo-6,6a,7,7a,8,12a-hexahydroanthra[3,2-g]quinoline-10-carboxamide.
| Compound Name | (6S,6aR,7aS,8S,11aS)-8-(dimethylamino)-6-(4-fluorophenyl)-11a,14-dihydroxy-9,11,12,13-tetraoxo-6,6a,7,7a,8,12a-hexahydroanthra[3,2-g]quinoline-10-carboxamide |
|---|---|
| PubChem CID | 91061032 |
| Molecular Formula | C30H26FN3O7 |
| Molecular Weight | 559.55 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | (6S,6aR,7aS,8S,11aS)-8-(dimethylamino)-6-(4-fluorophenyl)-11a,14-dihydroxy-9,11,12,13-tetraoxo-6,6a,7,7a,8,12a-hexahydroanthra[3,2-g]quinoline-10-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(cc5cccnc5c4O)[C@H](c4ccc(F)cc4)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C30H26FN3O7/c1-34(2)23-17-11-16-18(12-5-7-14(31)8-6-12)15-10-13-4-3-9-33-22(13)25(36)19(15)24(35)20(16)27(38)30(17,41)28(39)21(26(23)37)29(32)40/h3-10,16-18,20-21,23,36,41H,11H2,1-2H3,(H2,32,40)/t16-,17+,18+,20?,21?,23+,30+/m1/s1 |
| InChIKey | MTXIQYVRQKRPHZ-OGZRCIHZSA-N |
| XLogP | 1.14 |
| TPSA | 167.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.55 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|