About bis(methylimino)azanium;triphenylazanium
bis(methylimino)azanium;triphenylazanium (PubChem CID 91061255) has the molecular formula C20H22N4+2
and a molecular weight of 318.42 g/mol. Its IUPAC name is bis(methylimino)azanium;triphenylazanium.
Molecular Properties
| Compound Name | bis(methylimino)azanium;triphenylazanium |
| PubChem CID | 91061255 |
| Molecular Formula | C20H22N4+2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | bis(methylimino)azanium;triphenylazanium |
| SMILES | CN=[N+]=NC.c1ccc([NH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.C2H6N3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-5-4-2/h1-15H;1-2H3/q;+1/p+1 |
| InChIKey | CUJJJEXMRMQVDV-UHFFFAOYSA-O |
| XLogP | 4.08 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze bis(methylimino)azanium;triphenylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(methylimino)azanium;triphenylazanium?
The IUPAC name of bis(methylimino)azanium;triphenylazanium (CID 91061255) is bis(methylimino)azanium;triphenylazanium.
What is the SMILES notation for bis(methylimino)azanium;triphenylazanium?
The canonical SMILES for bis(methylimino)azanium;triphenylazanium is CN=[N+]=NC.c1ccc([NH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bis(methylimino)azanium;triphenylazanium?
The InChIKey is CUJJJEXMRMQVDV-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15N.C2H6N3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-5-4-2/h1-15H;1-2H3/q;+1/p+1.
What are the key properties of bis(methylimino)azanium;triphenylazanium?
bis(methylimino)azanium;triphenylazanium has a molecular weight of 318.42 g/mol, XLogP of 4.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(methylimino)azanium;triphenylazanium is sourced from PubChem (CID 91061255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).