About [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate
[2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 9106134) has the molecular formula C14H13N3O4S
and a molecular weight of 319.34 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate.
Molecular Properties
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate |
| PubChem CID | 9106134 |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)CN2CSCC2=O)cc1 |
| InChI | InChI=1S/C14H13N3O4S/c15-5-10-1-3-11(4-2-10)16-12(18)7-21-14(20)6-17-9-22-8-13(17)19/h1-4H,6-9H2,(H,16,18) |
| InChIKey | NOVIWWNLWPFKGA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate?
The IUPAC name of [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate (CID 9106134) is [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate.
What is the SMILES notation for [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate?
The canonical SMILES for [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate is N#Cc1ccc(NC(=O)COC(=O)CN2CSCC2=O)cc1.
What is the InChIKey of [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate?
The InChIKey is NOVIWWNLWPFKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O4S/c15-5-10-1-3-11(4-2-10)16-12(18)7-21-14(20)6-17-9-22-8-13(17)19/h1-4H,6-9H2,(H,16,18).
What are the key properties of [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate?
[2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate has a molecular weight of 319.34 g/mol, XLogP of 0.57, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate is sourced from PubChem (CID 9106134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).