About 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one
4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one (PubChem CID 91061884) has the molecular formula C26H20FN3O3
and a molecular weight of 441.46 g/mol. Its IUPAC name is 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one.
Molecular Properties
| Compound Name | 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
| PubChem CID | 91061884 |
| Molecular Formula | C26H20FN3O3 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cc2ccc(F)c(-n3c(O)cc(Cc4ccccc4)c3O)c2)c2ccccc12 |
| InChI | InChI=1S/C26H20FN3O3/c27-21-11-10-17(13-22-19-8-4-5-9-20(19)25(32)29-28-22)14-23(21)30-24(31)15-18(26(30)33)12-16-6-2-1-3-7-16/h1-11,14-15,31,33H,12-13H2,(H,29,32) |
| InChIKey | UBDWJBVPOBEJCV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one?
The IUPAC name of 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one (CID 91061884) is 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one.
What is the SMILES notation for 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one?
The canonical SMILES for 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one is O=c1[nH]nc(Cc2ccc(F)c(-n3c(O)cc(Cc4ccccc4)c3O)c2)c2ccccc12.
What is the InChIKey of 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one?
The InChIKey is UBDWJBVPOBEJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20FN3O3/c27-21-11-10-17(13-22-19-8-4-5-9-20(19)25(32)29-28-22)14-23(21)30-24(31)15-18(26(30)33)12-16-6-2-1-3-7-16/h1-11,14-15,31,33H,12-13H2,(H,29,32).
What are the key properties of 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one?
4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one has a molecular weight of 441.46 g/mol, XLogP of 4.45, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(3-benzyl-2,5-dihydroxypyrrol-1-yl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one is sourced from PubChem (CID 91061884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).