About ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol
ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol (PubChem CID 91062180) has the molecular formula C10H11F9O
and a molecular weight of 318.18 g/mol. Its IUPAC name is ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol.
Molecular Properties
| Compound Name | ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol |
| PubChem CID | 91062180 |
| Molecular Formula | C10H11F9O |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol |
| SMILES | CC.OC1(C(F)(F)F)C=CCC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H5F9O.C2H6/c9-6(10,11)4(7(12,13)14)2-1-3-5(4,18)8(15,16)17;1-2/h1,3,18H,2H2;1-2H3 |
| InChIKey | DVBJPKJGRSTMRQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol?
The IUPAC name of ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol (CID 91062180) is ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol.
What is the SMILES notation for ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol?
The canonical SMILES for ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol is CC.OC1(C(F)(F)F)C=CCC1(C(F)(F)F)C(F)(F)F.
What is the InChIKey of ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol?
The InChIKey is DVBJPKJGRSTMRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F9O.C2H6/c9-6(10,11)4(7(12,13)14)2-1-3-5(4,18)8(15,16)17;1-2/h1,3,18H,2H2;1-2H3.
What are the key properties of ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol?
ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol has a molecular weight of 318.18 g/mol, XLogP of 4.38, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,5,5-tris(trifluoromethyl)cyclopent-2-en-1-ol is sourced from PubChem (CID 91062180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).