C19H25F2NO8S — CID 91062500
8-hydroxyoctyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate (PubChem CID 91062500) has the molecular formula C19H25F2NO8S and a molecular weight of 465.47 g/mol. Its IUPAC name is 8-hydroxyoctyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate.
| Compound Name | 8-hydroxyoctyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 91062500 |
| Molecular Formula | C19H25F2NO8S |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 8-hydroxyoctyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate |
| SMILES | O=C(OCCCCCCCCO)C(F)(F)S(=O)(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C19H25F2NO8S/c20-19(21,18(26)29-10-6-4-2-1-3-5-9-23)31(27,28)30-22-16(24)14-12-7-8-13(11-12)15(14)17(22)25/h7-8,12-13,23-25H,1-6,9-11H2 |
| InChIKey | FHSYIHLSKCWPRS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|