About 10-hydroxy-N,N,9-trimethylundec-6-enamide
10-hydroxy-N,N,9-trimethylundec-6-enamide (PubChem CID 91063059) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is 10-hydroxy-N,N,9-trimethylundec-6-enamide.
Molecular Properties
| Compound Name | 10-hydroxy-N,N,9-trimethylundec-6-enamide |
| PubChem CID | 91063059 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 10-hydroxy-N,N,9-trimethylundec-6-enamide |
| SMILES | CC(O)C(C)CC=CCCCCC(=O)N(C)C |
| InChI | InChI=1S/C14H27NO2/c1-12(13(2)16)10-8-6-5-7-9-11-14(17)15(3)4/h6,8,12-13,16H,5,7,9-11H2,1-4H3 |
| InChIKey | AAHFTDGJDXPGIB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-hydroxy-N,N,9-trimethylundec-6-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-hydroxy-N,N,9-trimethylundec-6-enamide?
The IUPAC name of 10-hydroxy-N,N,9-trimethylundec-6-enamide (CID 91063059) is 10-hydroxy-N,N,9-trimethylundec-6-enamide.
What is the SMILES notation for 10-hydroxy-N,N,9-trimethylundec-6-enamide?
The canonical SMILES for 10-hydroxy-N,N,9-trimethylundec-6-enamide is CC(O)C(C)CC=CCCCCC(=O)N(C)C.
What is the InChIKey of 10-hydroxy-N,N,9-trimethylundec-6-enamide?
The InChIKey is AAHFTDGJDXPGIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-12(13(2)16)10-8-6-5-7-9-11-14(17)15(3)4/h6,8,12-13,16H,5,7,9-11H2,1-4H3.
What are the key properties of 10-hydroxy-N,N,9-trimethylundec-6-enamide?
10-hydroxy-N,N,9-trimethylundec-6-enamide has a molecular weight of 241.37 g/mol, XLogP of 2.60, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-hydroxy-N,N,9-trimethylundec-6-enamide is sourced from PubChem (CID 91063059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).