About 3,6-dimethylidenecyclohexa-1,4-diene;ethane
3,6-dimethylidenecyclohexa-1,4-diene;ethane (PubChem CID 91063078) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is 3,6-dimethylidenecyclohexa-1,4-diene;ethane.
Molecular Properties
| Compound Name | 3,6-dimethylidenecyclohexa-1,4-diene;ethane |
| PubChem CID | 91063078 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 3,6-dimethylidenecyclohexa-1,4-diene;ethane |
| SMILES | C=c1ccc(=C)cc1.CC.CC.CC |
| InChI | InChI=1S/C8H8.3C2H6/c1-7-3-5-8(2)6-4-7;3*1-2/h3-6H,1-2H2;3*1-2H3 |
| InChIKey | PVZZQVZTZDQBRH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,6-dimethylidenecyclohexa-1,4-diene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethylidenecyclohexa-1,4-diene;ethane?
The IUPAC name of 3,6-dimethylidenecyclohexa-1,4-diene;ethane (CID 91063078) is 3,6-dimethylidenecyclohexa-1,4-diene;ethane.
What is the SMILES notation for 3,6-dimethylidenecyclohexa-1,4-diene;ethane?
The canonical SMILES for 3,6-dimethylidenecyclohexa-1,4-diene;ethane is C=c1ccc(=C)cc1.CC.CC.CC.
What is the InChIKey of 3,6-dimethylidenecyclohexa-1,4-diene;ethane?
The InChIKey is PVZZQVZTZDQBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.3C2H6/c1-7-3-5-8(2)6-4-7;3*1-2/h3-6H,1-2H2;3*1-2H3.
What are the key properties of 3,6-dimethylidenecyclohexa-1,4-diene;ethane?
3,6-dimethylidenecyclohexa-1,4-diene;ethane has a molecular weight of 194.36 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethylidenecyclohexa-1,4-diene;ethane is sourced from PubChem (CID 91063078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).