About 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial
2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial (PubChem CID 91063080) has the molecular formula C7H11N2S2+
and a molecular weight of 187.31 g/mol. Its IUPAC name is 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial.
Molecular Properties
| Compound Name | 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial |
| PubChem CID | 91063080 |
| Molecular Formula | C7H11N2S2+ |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial |
| SMILES | C[N+]1=CN(C(C=S)C=S)CC1 |
| InChI | InChI=1S/C7H11N2S2/c1-8-2-3-9(6-8)7(4-10)5-11/h4-7H,2-3H2,1H3/q+1 |
| InChIKey | YPBFBSMKDAKEQD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial?
The IUPAC name of 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial (CID 91063080) is 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial.
What is the SMILES notation for 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial?
The canonical SMILES for 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial is C[N+]1=CN(C(C=S)C=S)CC1.
What is the InChIKey of 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial?
The InChIKey is YPBFBSMKDAKEQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N2S2/c1-8-2-3-9(6-8)7(4-10)5-11/h4-7H,2-3H2,1H3/q+1.
What are the key properties of 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial?
2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial has a molecular weight of 187.31 g/mol, XLogP of 0.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)propanedithial is sourced from PubChem (CID 91063080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).