C11H15F7S — CID 91064009
3-ethyl-4,4,5,5,6,6,6-heptafluoro-1-propylsulfanylhex-2-ene (PubChem CID 91064009) has the molecular formula C11H15F7S and a molecular weight of 312.29 g/mol. Its IUPAC name is 3-ethyl-4,4,5,5,6,6,6-heptafluoro-1-propylsulfanylhex-2-ene.
| Compound Name | 3-ethyl-4,4,5,5,6,6,6-heptafluoro-1-propylsulfanylhex-2-ene |
|---|---|
| PubChem CID | 91064009 |
| Molecular Formula | C11H15F7S |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 3-ethyl-4,4,5,5,6,6,6-heptafluoro-1-propylsulfanylhex-2-ene |
| SMILES | CCCSCC=C(CC)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H15F7S/c1-3-6-19-7-5-8(4-2)9(12,13)10(14,15)11(16,17)18/h5H,3-4,6-7H2,1-2H3 |
| InChIKey | VODYVGMISJAZCI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|