C40H74S8 — CID 91064555
1-[4-[1,3,3-tris[4-(2-sulfanylpropylsulfanyl)cyclohexyl]butyl]cyclohexyl]sulfanylpropane-2-thiol (PubChem CID 91064555) has the molecular formula C40H74S8 and a molecular weight of 811.57 g/mol. Its IUPAC name is 1-[4-[1,3,3-tris[4-(2-sulfanylpropylsulfanyl)cyclohexyl]butyl]cyclohexyl]sulfanylpropane-2-thiol.
| Compound Name | 1-[4-[1,3,3-tris[4-(2-sulfanylpropylsulfanyl)cyclohexyl]butyl]cyclohexyl]sulfanylpropane-2-thiol |
|---|---|
| PubChem CID | 91064555 |
| Molecular Formula | C40H74S8 |
| Molecular Weight | 811.57 g/mol |
| Exact Mass | 810.36 |
| IUPAC Name | 1-[4-[1,3,3-tris[4-(2-sulfanylpropylsulfanyl)cyclohexyl]butyl]cyclohexyl]sulfanylpropane-2-thiol |
| SMILES | CC(S)CSC1CCC(C(CC(C)(C2CCC(SCC(C)S)CC2)C2CCC(SCC(C)S)CC2)C2CCC(SCC(C)S)CC2)CC1 |
| InChI | InChI=1S/C40H74S8/c1-27(41)23-45-35-14-6-31(7-15-35)39(32-8-16-36(17-9-32)46-24-28(2)42)22-40(5,33-10-18-37(19-11-33)47-25-29(3)43)34-12-20-38(21-13-34)48-26-30(4)44/h27-39,41-44H,6-26H2,1-5H3 |
| InChIKey | IRZZXLNKVHFLTQ-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.57 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|