About (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine
(4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine (PubChem CID 91064599) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine |
| PubChem CID | 91064599 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine |
| SMILES | CC[C@@H](C)[C@H]1COC(C)(C)N1 |
| InChI | InChI=1S/C9H19NO/c1-5-7(2)8-6-11-9(3,4)10-8/h7-8,10H,5-6H2,1-4H3/t7-,8-/m1/s1 |
| InChIKey | NFMQGQMCNWXWEU-HTQZYQBOSA-N |
| XLogP | 1.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine?
The IUPAC name of (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine (CID 91064599) is (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine.
What is the SMILES notation for (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine?
The canonical SMILES for (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine is CC[C@@H](C)[C@H]1COC(C)(C)N1.
What is the InChIKey of (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine?
The InChIKey is NFMQGQMCNWXWEU-HTQZYQBOSA-N. The full InChI is InChI=1S/C9H19NO/c1-5-7(2)8-6-11-9(3,4)10-8/h7-8,10H,5-6H2,1-4H3/t7-,8-/m1/s1.
What are the key properties of (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine?
(4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine has a molecular weight of 157.26 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[(2R)-butan-2-yl]-2,2-dimethyl-1,3-oxazolidine is sourced from PubChem (CID 91064599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).