About 4-ethoxybenzenethiol
4-ethoxybenzenethiol (PubChem CID 9106508) has the molecular formula C8H10OS
and a molecular weight of 154.23 g/mol. Its IUPAC name is 4-ethoxybenzenethiol.
Molecular Properties
| Compound Name | 4-ethoxybenzenethiol |
| PubChem CID | 9106508 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 4-ethoxybenzenethiol |
| SMILES | CCOc1ccc(S)cc1 |
| InChI | InChI=1S/C8H10OS/c1-2-9-7-3-5-8(10)6-4-7/h3-6,10H,2H2,1H3 |
| InChIKey | OXWOIUVGAWIZQQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxybenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxybenzenethiol?
The IUPAC name of 4-ethoxybenzenethiol (CID 9106508) is 4-ethoxybenzenethiol.
What is the SMILES notation for 4-ethoxybenzenethiol?
The canonical SMILES for 4-ethoxybenzenethiol is CCOc1ccc(S)cc1.
What is the InChIKey of 4-ethoxybenzenethiol?
The InChIKey is OXWOIUVGAWIZQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10OS/c1-2-9-7-3-5-8(10)6-4-7/h3-6,10H,2H2,1H3.
What are the key properties of 4-ethoxybenzenethiol?
4-ethoxybenzenethiol has a molecular weight of 154.23 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxybenzenethiol is sourced from PubChem (CID 9106508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).