C18H22N2O6S — CID 9106537
N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-2,4-dimethoxybenzamide (PubChem CID 9106537) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 9106537 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(OC)c(S(=O)(=O)N(C)C)c2)c(OC)c1 |
| InChI | InChI=1S/C18H22N2O6S/c1-20(2)27(22,23)17-10-12(6-9-15(17)25-4)19-18(21)14-8-7-13(24-3)11-16(14)26-5/h6-11H,1-5H3,(H,19,21) |
| InChIKey | ZWDFZNNZVYUONA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |