C23H21FN4O4S — CID 91065424
(1R,2S,7R,8S)-5-(1,1-dioxo-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-yl)-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione (PubChem CID 91065424) has the molecular formula C23H21FN4O4S and a molecular weight of 468.51 g/mol. Its IUPAC name is (1R,2S,7R,8S)-5-(1,1-dioxo-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-yl)-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione.
| Compound Name | (1R,2S,7R,8S)-5-(1,1-dioxo-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-yl)-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
|---|---|
| PubChem CID | 91065424 |
| Molecular Formula | C23H21FN4O4S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (1R,2S,7R,8S)-5-(1,1-dioxo-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-yl)-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
| SMILES | O=C1C(C2=NS(=O)(=O)c3cccnc3N2)C(=O)N(Cc2ccc(F)cc2)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]12 |
| InChI | InChI=1S/C23H21FN4O4S/c24-15-7-3-12(4-8-15)11-28-19-14-6-5-13(10-14)17(19)20(29)18(23(28)30)22-26-21-16(2-1-9-25-21)33(31,32)27-22/h1-4,7-9,13-14,17-19H,5-6,10-11H2,(H,25,26,27)/t13-,14+,17+,18?,19-/m0/s1 |
| InChIKey | DOEMEGGFEXGNEC-KAKFFSKPSA-N |
| XLogP | 2.38 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|