C20H22N8O — CID 91065587
4-(3H-benzimidazol-5-yl)-N-(2,5-dihydropyridin-2-ylmethyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 91065587) has the molecular formula C20H22N8O and a molecular weight of 390.45 g/mol. Its IUPAC name is 4-(3H-benzimidazol-5-yl)-N-(2,5-dihydropyridin-2-ylmethyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3H-benzimidazol-5-yl)-N-(2,5-dihydropyridin-2-ylmethyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 91065587 |
| Molecular Formula | C20H22N8O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-(3H-benzimidazol-5-yl)-N-(2,5-dihydropyridin-2-ylmethyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | C1=CC(CNc2nc(-c3ccc4nc[nH]c4c3)nc(N3CCOCC3)n2)N=CC1 |
| InChI | InChI=1S/C20H22N8O/c1-2-6-21-15(3-1)12-22-19-25-18(14-4-5-16-17(11-14)24-13-23-16)26-20(27-19)28-7-9-29-10-8-28/h1,3-6,11,13,15H,2,7-10,12H2,(H,23,24)(H,22,25,26,27) |
| InChIKey | CZDVOPBREHZGIV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|