About (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea
(6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea (PubChem CID 91065745) has the molecular formula C5H8N4O2
and a molecular weight of 156.15 g/mol. Its IUPAC name is (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea.
Molecular Properties
| Compound Name | (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea |
| PubChem CID | 91065745 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea |
| SMILES | NC(=O)NC1N=CCC(=O)N1 |
| InChI | InChI=1S/C5H8N4O2/c6-4(11)9-5-7-2-1-3(10)8-5/h2,5H,1H2,(H,8,10)(H3,6,9,11) |
| InChIKey | UYEPXAKKTUJSRA-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea?
The IUPAC name of (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea (CID 91065745) is (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea.
What is the SMILES notation for (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea?
The canonical SMILES for (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea is NC(=O)NC1N=CCC(=O)N1.
What is the InChIKey of (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea?
The InChIKey is UYEPXAKKTUJSRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2/c6-4(11)9-5-7-2-1-3(10)8-5/h2,5H,1H2,(H,8,10)(H3,6,9,11).
What are the key properties of (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea?
(6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea has a molecular weight of 156.15 g/mol, XLogP of -1.47, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-oxo-2,5-dihydro-1H-pyrimidin-2-yl)urea is sourced from PubChem (CID 91065745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).