C10H14O3 — CID 91065768
2,6-dimethylcyclohexa-2,5-diene-1,4-dione;ethanol (PubChem CID 91065768) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,6-dimethylcyclohexa-2,5-diene-1,4-dione;ethanol.
| Compound Name | 2,6-dimethylcyclohexa-2,5-diene-1,4-dione;ethanol |
|---|---|
| PubChem CID | 91065768 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,6-dimethylcyclohexa-2,5-diene-1,4-dione;ethanol |
| SMILES | CC1=CC(=O)C=C(C)C1=O.CCO |
| InChI | InChI=1S/C8H8O2.C2H6O/c1-5-3-7(9)4-6(2)8(5)10;1-2-3/h3-4H,1-2H3;3H,2H2,1H3 |
| InChIKey | AJAOKQWRSLYHDE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|