C23H23N3O2 — CID 91065803
2-[6-[2-[(3aS,5S,6R,7S,7aR)-5,6-dimethyl-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-7-yl]ethenyl]-3-pyridinyl]benzonitrile (PubChem CID 91065803) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[6-[2-[(3aS,5S,6R,7S,7aR)-5,6-dimethyl-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-7-yl]ethenyl]-3-pyridinyl]benzonitrile.
| Compound Name | 2-[6-[2-[(3aS,5S,6R,7S,7aR)-5,6-dimethyl-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-7-yl]ethenyl]-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 91065803 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[6-[2-[(3aS,5S,6R,7S,7aR)-5,6-dimethyl-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-7-yl]ethenyl]-3-pyridinyl]benzonitrile |
| SMILES | C[C@H]1[C@H](C=Cc2ccc(-c3ccccc3C#N)cn2)[C@H]2OC(=O)N[C@H]2C[C@@H]1C |
| InChI | InChI=1S/C23H23N3O2/c1-14-11-21-22(28-23(27)26-21)19(15(14)2)10-9-18-8-7-17(13-25-18)20-6-4-3-5-16(20)12-24/h3-10,13-15,19,21-22H,11H2,1-2H3,(H,26,27)/t14-,15+,19-,21-,22+/m0/s1 |
| InChIKey | YAKQKJNSHOTGAH-AINIZBMHSA-N |
| XLogP | 4.40 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |