About 1-buta-1,3-dienyl-1-methylhydrazine
1-buta-1,3-dienyl-1-methylhydrazine (PubChem CID 91065871) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 1-buta-1,3-dienyl-1-methylhydrazine.
Molecular Properties
| Compound Name | 1-buta-1,3-dienyl-1-methylhydrazine |
| PubChem CID | 91065871 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 1-buta-1,3-dienyl-1-methylhydrazine |
| SMILES | C=CC=CN(C)N |
| InChI | InChI=1S/C5H10N2/c1-3-4-5-7(2)6/h3-5H,1,6H2,2H3 |
| InChIKey | UAOQJZXZWHZXKA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-dienyl-1-methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-dienyl-1-methylhydrazine?
The IUPAC name of 1-buta-1,3-dienyl-1-methylhydrazine (CID 91065871) is 1-buta-1,3-dienyl-1-methylhydrazine.
What is the SMILES notation for 1-buta-1,3-dienyl-1-methylhydrazine?
The canonical SMILES for 1-buta-1,3-dienyl-1-methylhydrazine is C=CC=CN(C)N.
What is the InChIKey of 1-buta-1,3-dienyl-1-methylhydrazine?
The InChIKey is UAOQJZXZWHZXKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c1-3-4-5-7(2)6/h3-5H,1,6H2,2H3.
What are the key properties of 1-buta-1,3-dienyl-1-methylhydrazine?
1-buta-1,3-dienyl-1-methylhydrazine has a molecular weight of 98.15 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-dienyl-1-methylhydrazine is sourced from PubChem (CID 91065871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).