C17H29FO3 — CID 91066192
propyl (Z)-7-[(1R,2R,3S,5S)-2-ethyl-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate (PubChem CID 91066192) has the molecular formula C17H29FO3 and a molecular weight of 300.41 g/mol. Its IUPAC name is propyl (Z)-7-[(1R,2R,3S,5S)-2-ethyl-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | propyl (Z)-7-[(1R,2R,3S,5S)-2-ethyl-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91066192 |
| Molecular Formula | C17H29FO3 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | propyl (Z)-7-[(1R,2R,3S,5S)-2-ethyl-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate |
| SMILES | CCCOC(=O)CCC/C=C\C[C@@H]1[C@@H](CC)[C@@H](F)C[C@@H]1O |
| InChI | InChI=1S/C17H29FO3/c1-3-11-21-17(20)10-8-6-5-7-9-14-13(4-2)15(18)12-16(14)19/h5,7,13-16,19H,3-4,6,8-12H2,1-2H3/b7-5-/t13-,14-,15+,16+/m1/s1 |
| InChIKey | ZGHONWHIVDQLFR-KJOHQJPUSA-N |
| XLogP | 3.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|