About 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine
1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine (PubChem CID 91066355) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine.
Molecular Properties
| Compound Name | 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine |
| PubChem CID | 91066355 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine |
| SMILES | C1=CCC(N2CCNCC2)NC1 |
| InChI | InChI=1S/C9H17N3/c1-2-4-11-9(3-1)12-7-5-10-6-8-12/h1-2,9-11H,3-8H2 |
| InChIKey | CDNXLXATRSIIBW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine?
The IUPAC name of 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine (CID 91066355) is 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine.
What is the SMILES notation for 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine?
The canonical SMILES for 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine is C1=CCC(N2CCNCC2)NC1.
What is the InChIKey of 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine?
The InChIKey is CDNXLXATRSIIBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3/c1-2-4-11-9(3-1)12-7-5-10-6-8-12/h1-2,9-11H,3-8H2.
What are the key properties of 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine?
1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine has a molecular weight of 167.26 g/mol, XLogP of -0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,3,6-tetrahydropyridin-2-yl)piperazine is sourced from PubChem (CID 91066355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).