C41H28N7O5- — CID 91066842
4-[6-[3-[5-(4-carboxyphenyl)-4,6-dicyano-6-isocyanohexa-1,3,5-trienyl]-2-morpholin-4-ylcyclopent-2-en-1-ylidene]-1,3-dicyano-1-isocyanohexa-2,4-dien-2-yl]benzoic acid (PubChem CID 91066842) has the molecular formula C41H28N7O5- and a molecular weight of 698.72 g/mol. Its IUPAC name is 4-[6-[3-[5-(4-carboxyphenyl)-4,6-dicyano-6-isocyanohexa-1,3,5-trienyl]-2-morpholin-4-ylcyclopent-2-en-1-ylidene]-1,3-dicyano-1-isocyanohexa-2,4-dien-2-yl]benzoic acid.
| Compound Name | 4-[6-[3-[5-(4-carboxyphenyl)-4,6-dicyano-6-isocyanohexa-1,3,5-trienyl]-2-morpholin-4-ylcyclopent-2-en-1-ylidene]-1,3-dicyano-1-isocyanohexa-2,4-dien-2-yl]benzoic acid |
|---|---|
| PubChem CID | 91066842 |
| Molecular Formula | C41H28N7O5- |
| Molecular Weight | 698.72 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | 4-[6-[3-[5-(4-carboxyphenyl)-4,6-dicyano-6-isocyanohexa-1,3,5-trienyl]-2-morpholin-4-ylcyclopent-2-en-1-ylidene]-1,3-dicyano-1-isocyanohexa-2,4-dien-2-yl]benzoic acid |
| SMILES | [C-]#[N+]C(C#N)=C(C(C#N)=CC=CC1=C(N2CCOCC2)C(=CC=CC(C#N)=C(c2ccc(C(=O)O)cc2)[C-](C#N)[N+]#[C-])CC1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C41H28N7O5/c1-46-35(25-44)37(27-9-15-31(16-10-27)40(49)50)33(23-42)7-3-5-29-13-14-30(39(29)48-19-21-53-22-20-48)6-4-8-34(24-43)38(36(26-45)47-2)28-11-17-32(18-12-28)41(51)52/h3-12,15-18H,13-14,19-22H2,(H,49,50)(H,51,52)/q-1 |
| InChIKey | HTLLQMBKNHLRJX-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 190.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.72 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|