C25H48N4O5 — CID 91066901
tert-butyl N-[1-hydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]pentyl]-N-piperidin-4-ylcarbamate (PubChem CID 91066901) has the molecular formula C25H48N4O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is tert-butyl N-[1-hydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]pentyl]-N-piperidin-4-ylcarbamate.
| Compound Name | tert-butyl N-[1-hydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]pentyl]-N-piperidin-4-ylcarbamate |
|---|---|
| PubChem CID | 91066901 |
| Molecular Formula | C25H48N4O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | tert-butyl N-[1-hydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]pentyl]-N-piperidin-4-ylcarbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CCCCC(O)N(C(=O)OC(C)(C)C)C2CCNCC2)CC1 |
| InChI | InChI=1S/C25H48N4O5/c1-24(2,3)33-22(31)27-19-12-17-28(18-13-19)16-8-7-9-21(30)29(20-10-14-26-15-11-20)23(32)34-25(4,5)6/h19-21,26,30H,7-18H2,1-6H3,(H,27,31) |
| InChIKey | WSPNARRFDLQWGR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|