C21H21NO2 — CID 91067305
2,5-bis[(3-methoxyphenyl)methyl]pyridine (PubChem CID 91067305) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2,5-bis[(3-methoxyphenyl)methyl]pyridine.
| Compound Name | 2,5-bis[(3-methoxyphenyl)methyl]pyridine |
|---|---|
| PubChem CID | 91067305 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2,5-bis[(3-methoxyphenyl)methyl]pyridine |
| SMILES | COc1cccc(Cc2ccc(Cc3cccc(OC)c3)nc2)c1 |
| InChI | InChI=1S/C21H21NO2/c1-23-20-7-3-5-16(13-20)11-18-9-10-19(22-15-18)12-17-6-4-8-21(14-17)24-2/h3-10,13-15H,11-12H2,1-2H3 |
| InChIKey | GMXGJUHDMRGSMJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |