C49H55FN6O4 — CID 91067545
1-[1-[[3-(2-fluoroethoxy)-4-methoxyphenyl]methyl]piperidin-4-yl]-2-[1-[(4-methoxy-3-prop-2-enoxyphenyl)methyl]piperidin-4-yl]-1,2-di(quinolin-4-yl)hydrazine (PubChem CID 91067545) has the molecular formula C49H55FN6O4 and a molecular weight of 811.02 g/mol. Its IUPAC name is 1-[1-[[3-(2-fluoroethoxy)-4-methoxyphenyl]methyl]piperidin-4-yl]-2-[1-[(4-methoxy-3-prop-2-enoxyphenyl)methyl]piperidin-4-yl]-1,2-di(quinolin-4-yl)hydrazine.
| Compound Name | 1-[1-[[3-(2-fluoroethoxy)-4-methoxyphenyl]methyl]piperidin-4-yl]-2-[1-[(4-methoxy-3-prop-2-enoxyphenyl)methyl]piperidin-4-yl]-1,2-di(quinolin-4-yl)hydrazine |
|---|---|
| PubChem CID | 91067545 |
| Molecular Formula | C49H55FN6O4 |
| Molecular Weight | 811.02 g/mol |
| Exact Mass | 810.43 |
| IUPAC Name | 1-[1-[[3-(2-fluoroethoxy)-4-methoxyphenyl]methyl]piperidin-4-yl]-2-[1-[(4-methoxy-3-prop-2-enoxyphenyl)methyl]piperidin-4-yl]-1,2-di(quinolin-4-yl)hydrazine |
| SMILES | C=CCOc1cc(CN2CCC(N(c3ccnc4ccccc34)N(c3ccnc4ccccc34)C3CCN(Cc4ccc(OC)c(OCCF)c4)CC3)CC2)ccc1OC |
| InChI | InChI=1S/C49H55FN6O4/c1-4-30-59-48-32-36(13-15-46(48)57-2)34-53-26-19-38(20-27-53)55(44-17-24-51-42-11-7-5-9-40(42)44)56(45-18-25-52-43-12-8-6-10-41(43)45)39-21-28-54(29-22-39)35-37-14-16-47(58-3)49(33-37)60-31-23-50/h4-18,24-25,32-33,38-39H,1,19-23,26-31,34-35H2,2-3H3 |
| InChIKey | MXGJNXZGKAZINO-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.02 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|