C26H24N2O6S — CID 91067709
4-[(2S)-1-(benzylamino)-2-methyl-3-(3-thieno[2,3-d][1,2]oxazol-3-ylphenoxy)propan-2-yl]oxy-4-oxobut-2-enoic acid (PubChem CID 91067709) has the molecular formula C26H24N2O6S and a molecular weight of 492.55 g/mol. Its IUPAC name is 4-[(2S)-1-(benzylamino)-2-methyl-3-(3-thieno[2,3-d][1,2]oxazol-3-ylphenoxy)propan-2-yl]oxy-4-oxobut-2-enoic acid.
| Compound Name | 4-[(2S)-1-(benzylamino)-2-methyl-3-(3-thieno[2,3-d][1,2]oxazol-3-ylphenoxy)propan-2-yl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 91067709 |
| Molecular Formula | C26H24N2O6S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 4-[(2S)-1-(benzylamino)-2-methyl-3-(3-thieno[2,3-d][1,2]oxazol-3-ylphenoxy)propan-2-yl]oxy-4-oxobut-2-enoic acid |
| SMILES | C[C@](CNCc1ccccc1)(COc1cccc(-c2noc3ccsc23)c1)OC(=O)C=CC(=O)O |
| InChI | InChI=1S/C26H24N2O6S/c1-26(33-23(31)11-10-22(29)30,16-27-15-18-6-3-2-4-7-18)17-32-20-9-5-8-19(14-20)24-25-21(34-28-24)12-13-35-25/h2-14,27H,15-17H2,1H3,(H,29,30)/t26-/m0/s1 |
| InChIKey | XEMZUTHSYNQRPX-SANMLTNESA-N |
| XLogP | 4.67 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|