C18H24ClFNO+ — CID 91068304
2-[4-chloro-1-(cycloheptylmethyl)-6-fluoroindol-1-ium-1-yl]ethanol (PubChem CID 91068304) has the molecular formula C18H24ClFNO+ and a molecular weight of 324.85 g/mol. Its IUPAC name is 2-[4-chloro-1-(cycloheptylmethyl)-6-fluoroindol-1-ium-1-yl]ethanol.
| Compound Name | 2-[4-chloro-1-(cycloheptylmethyl)-6-fluoroindol-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 91068304 |
| Molecular Formula | C18H24ClFNO+ |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[4-chloro-1-(cycloheptylmethyl)-6-fluoroindol-1-ium-1-yl]ethanol |
| SMILES | OCC[N+]1(CC2CCCCCC2)C=Cc2c(Cl)cc(F)cc21 |
| InChI | InChI=1S/C18H24ClFNO/c19-17-11-15(20)12-18-16(17)7-8-21(18,9-10-22)13-14-5-3-1-2-4-6-14/h7-8,11-12,14,22H,1-6,9-10,13H2/q+1 |
| InChIKey | DCRVFFBGAGOHAH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|