About 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine
1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine (PubChem CID 91068305) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine |
| PubChem CID | 91068305 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine |
| SMILES | CC1(C)CCN(C2=CCCC=C2)CC1 |
| InChI | InChI=1S/C13H21N/c1-13(2)8-10-14(11-9-13)12-6-4-3-5-7-12/h4,6-7H,3,5,8-11H2,1-2H3 |
| InChIKey | RNICVUXYMBSHGI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine?
The IUPAC name of 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine (CID 91068305) is 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine is CC1(C)CCN(C2=CCCC=C2)CC1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine?
The InChIKey is RNICVUXYMBSHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-13(2)8-10-14(11-9-13)12-6-4-3-5-7-12/h4,6-7H,3,5,8-11H2,1-2H3.
What are the key properties of 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine?
1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine has a molecular weight of 191.32 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-yl-4,4-dimethylpiperidine is sourced from PubChem (CID 91068305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).