C19H24ClN3O3 — CID 91068471
5-chloro-N-[5-[4-(oxan-2-yloxy)phenyl]-1H-pyrazol-3-yl]pentanamide (PubChem CID 91068471) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 5-chloro-N-[5-[4-(oxan-2-yloxy)phenyl]-1H-pyrazol-3-yl]pentanamide.
| Compound Name | 5-chloro-N-[5-[4-(oxan-2-yloxy)phenyl]-1H-pyrazol-3-yl]pentanamide |
|---|---|
| PubChem CID | 91068471 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 5-chloro-N-[5-[4-(oxan-2-yloxy)phenyl]-1H-pyrazol-3-yl]pentanamide |
| SMILES | O=C(CCCCCl)Nc1cc(-c2ccc(OC3CCCCO3)cc2)[nH]n1 |
| InChI | InChI=1S/C19H24ClN3O3/c20-11-3-1-5-18(24)21-17-13-16(22-23-17)14-7-9-15(10-8-14)26-19-6-2-4-12-25-19/h7-10,13,19H,1-6,11-12H2,(H2,21,22,23,24) |
| InChIKey | HUNRNKYCODEKJA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|