C22H31N3 — CID 91068673
4-[1-[cyclohexa-2,4-dien-1-yl(cyclohexen-1-yl)methyl]-4,5-dihydroimidazol-2-yl]cyclohex-3-en-1-amine (PubChem CID 91068673) has the molecular formula C22H31N3 and a molecular weight of 337.51 g/mol. Its IUPAC name is 4-[1-[cyclohexa-2,4-dien-1-yl(cyclohexen-1-yl)methyl]-4,5-dihydroimidazol-2-yl]cyclohex-3-en-1-amine.
| Compound Name | 4-[1-[cyclohexa-2,4-dien-1-yl(cyclohexen-1-yl)methyl]-4,5-dihydroimidazol-2-yl]cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 91068673 |
| Molecular Formula | C22H31N3 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 4-[1-[cyclohexa-2,4-dien-1-yl(cyclohexen-1-yl)methyl]-4,5-dihydroimidazol-2-yl]cyclohex-3-en-1-amine |
| SMILES | NC1CC=C(C2=NCCN2C(C2=CCCCC2)C2C=CC=CC2)CC1 |
| InChI | InChI=1S/C22H31N3/c23-20-13-11-19(12-14-20)22-24-15-16-25(22)21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1,3-4,7,9,11,17,20-21H,2,5-6,8,10,12-16,23H2 |
| InChIKey | NHBYOBTYEVVNSM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|