C15H16N4O3 — CID 910691
1,3,7-trimethyl-8-(3-methylphenoxy)purine-2,6-dione (PubChem CID 910691) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-(3-methylphenoxy)purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-(3-methylphenoxy)purine-2,6-dione |
|---|---|
| PubChem CID | 910691 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1,3,7-trimethyl-8-(3-methylphenoxy)purine-2,6-dione |
| SMILES | Cc1cccc(Oc2nc3c(c(=O)n(C)c(=O)n3C)n2C)c1 |
| InChI | InChI=1S/C15H16N4O3/c1-9-6-5-7-10(8-9)22-14-16-12-11(17(14)2)13(20)19(4)15(21)18(12)3/h5-8H,1-4H3 |
| InChIKey | PNLHQUSTGQLZOE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |