C28H42N8 — CID 91069140
7,14-dimethyl-5,12-dimethylidene-1-(5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-4,7,11,13-tetraen-1-yl)-1,4,8,11-tetrazacyclotetradeca-2,6,9,13-tetraene (PubChem CID 91069140) has the molecular formula C28H42N8 and a molecular weight of 490.70 g/mol. Its IUPAC name is 7,14-dimethyl-5,12-dimethylidene-1-(5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-4,7,11,13-tetraen-1-yl)-1,4,8,11-tetrazacyclotetradeca-2,6,9,13-tetraene.
| Compound Name | 7,14-dimethyl-5,12-dimethylidene-1-(5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-4,7,11,13-tetraen-1-yl)-1,4,8,11-tetrazacyclotetradeca-2,6,9,13-tetraene |
|---|---|
| PubChem CID | 91069140 |
| Molecular Formula | C28H42N8 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | 7,14-dimethyl-5,12-dimethylidene-1-(5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradeca-4,7,11,13-tetraen-1-yl)-1,4,8,11-tetrazacyclotetradeca-2,6,9,13-tetraene |
| SMILES | C=c1cc(C)[nH]cc[nH]c(=C)cc(C)n(N2CC/N=C(/C)C/C(C)=N\CC/N=C(/C)C=C2C)cc[nH]1 |
| InChI | InChI=1S/C28H42N8/c1-21-17-23(3)33-13-15-35(27(7)19-25(5)31-11-9-29-21)36-16-14-34-24(4)18-22(2)30-10-12-32-26(6)20-28(36)8/h9,11,13,15,17,19-20,29,31,33H,3,5,10,12,14,16,18H2,1-2,4,6-8H3/b11-9+,15-13+,21-17+,27-19+,28-20?,30-22-,32-26-,34-24- |
| InChIKey | XRUMLCLECQNAGQ-IQGLLEKXSA-N |
| XLogP | 3.91 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |