C30H34N2O2 — CID 91069528
2-(2-aminophenyl)-1-[7-[4-(4-ethylcyclohexyl)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone (PubChem CID 91069528) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is 2-(2-aminophenyl)-1-[7-[4-(4-ethylcyclohexyl)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone.
| Compound Name | 2-(2-aminophenyl)-1-[7-[4-(4-ethylcyclohexyl)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone |
|---|---|
| PubChem CID | 91069528 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 2-(2-aminophenyl)-1-[7-[4-(4-ethylcyclohexyl)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanone |
| SMILES | CCC1CCC(c2ccc(-c3ccc4c(c3)OCCN4C(=O)Cc3ccccc3N)cc2)CC1 |
| InChI | InChI=1S/C30H34N2O2/c1-2-21-7-9-22(10-8-21)23-11-13-24(14-12-23)25-15-16-28-29(19-25)34-18-17-32(28)30(33)20-26-5-3-4-6-27(26)31/h3-6,11-16,19,21-22H,2,7-10,17-18,20,31H2,1H3 |
| InChIKey | OSWWNTXEWAGQMZ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|