C19H9F4N3O — CID 9106981
2-pyridin-3-yl-4-(2,3,5,6-tetrafluorophenoxy)quinazoline (PubChem CID 9106981) has the molecular formula C19H9F4N3O and a molecular weight of 371.29 g/mol. Its IUPAC name is 2-pyridin-3-yl-4-(2,3,5,6-tetrafluorophenoxy)quinazoline.
| Compound Name | 2-pyridin-3-yl-4-(2,3,5,6-tetrafluorophenoxy)quinazoline |
|---|---|
| PubChem CID | 9106981 |
| Molecular Formula | C19H9F4N3O |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2-pyridin-3-yl-4-(2,3,5,6-tetrafluorophenoxy)quinazoline |
| SMILES | Fc1cc(F)c(F)c(Oc2nc(-c3cccnc3)nc3ccccc23)c1F |
| InChI | InChI=1S/C19H9F4N3O/c20-12-8-13(21)16(23)17(15(12)22)27-19-11-5-1-2-6-14(11)25-18(26-19)10-4-3-7-24-9-10/h1-9H |
| InChIKey | MLOLWXBYXQUTHQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|