C24H33N4O5+ — CID 91069839
propyl (2S)-2-[(2S)-1-(5-tert-butyl-3-carbamoyl-1,3,4-oxadiazol-3-ium-2-yl)-3-methyl-1-oxobutan-2-yl]-2,3-dihydroindole-1-carboxylate (PubChem CID 91069839) has the molecular formula C24H33N4O5+ and a molecular weight of 457.55 g/mol. Its IUPAC name is propyl (2S)-2-[(2S)-1-(5-tert-butyl-3-carbamoyl-1,3,4-oxadiazol-3-ium-2-yl)-3-methyl-1-oxobutan-2-yl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | propyl (2S)-2-[(2S)-1-(5-tert-butyl-3-carbamoyl-1,3,4-oxadiazol-3-ium-2-yl)-3-methyl-1-oxobutan-2-yl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 91069839 |
| Molecular Formula | C24H33N4O5+ |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | propyl (2S)-2-[(2S)-1-(5-tert-butyl-3-carbamoyl-1,3,4-oxadiazol-3-ium-2-yl)-3-methyl-1-oxobutan-2-yl]-2,3-dihydroindole-1-carboxylate |
| SMILES | CCCOC(=O)N1c2ccccc2C[C@H]1[C@@H](C(=O)c1oc(C(C)(C)C)n[n+]1C(N)=O)C(C)C |
| InChI | InChI=1S/C24H32N4O5/c1-7-12-32-23(31)27-16-11-9-8-10-15(16)13-17(27)18(14(2)3)19(29)20-28(22(25)30)26-21(33-20)24(4,5)6/h8-11,14,17-18H,7,12-13H2,1-6H3,(H-,25,30)/p+1/t17-,18-/m0/s1 |
| InChIKey | PNJRLIZTDOOPFF-ROUUACIJSA-O |
| XLogP | 3.62 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|