C14H17BrN2O — CID 91070069
8-benzyl-3-bromo-1-oxa-2,8-diazaspiro[4.5]dec-3-ene (PubChem CID 91070069) has the molecular formula C14H17BrN2O and a molecular weight of 309.21 g/mol. Its IUPAC name is 8-benzyl-3-bromo-1-oxa-2,8-diazaspiro[4.5]dec-3-ene.
| Compound Name | 8-benzyl-3-bromo-1-oxa-2,8-diazaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 91070069 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 8-benzyl-3-bromo-1-oxa-2,8-diazaspiro[4.5]dec-3-ene |
| SMILES | BrC1=CC2(CCN(Cc3ccccc3)CC2)ON1 |
| InChI | InChI=1S/C14H17BrN2O/c15-13-10-14(18-16-13)6-8-17(9-7-14)11-12-4-2-1-3-5-12/h1-5,10,16H,6-9,11H2 |
| InChIKey | PKBMXMOQBSGGDC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|