C9H2Br3F7S — CID 91070363
1,3,5-tribromo-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)benzene (PubChem CID 91070363) has the molecular formula C9H2Br3F7S and a molecular weight of 514.88 g/mol. Its IUPAC name is 1,3,5-tribromo-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)benzene.
| Compound Name | 1,3,5-tribromo-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)benzene |
|---|---|
| PubChem CID | 91070363 |
| Molecular Formula | C9H2Br3F7S |
| Molecular Weight | 514.88 g/mol |
| Exact Mass | 511.73 |
| IUPAC Name | 1,3,5-tribromo-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)Sc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C9H2Br3F7S/c10-3-1-4(11)6(5(12)2-3)20-9(18,19)7(13,14)8(15,16)17/h1-2H |
| InChIKey | ACWMPPDKGDXBBQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.88 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|